C15H15Cl2N — CID 112655906
3-chloro-4-[2-chloro-2-(2,5-dimethylphenyl)ethyl]pyridine (PubChem CID 112655906) has the molecular formula C15H15Cl2N and a molecular weight of 280.20 g/mol. Its IUPAC name is 3-chloro-4-[2-chloro-2-(2,5-dimethylphenyl)ethyl]pyridine.
| Compound Name | 3-chloro-4-[2-chloro-2-(2,5-dimethylphenyl)ethyl]pyridine |
|---|---|
| PubChem CID | 112655906 |
| Molecular Formula | C15H15Cl2N |
| Molecular Weight | 280.20 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-chloro-4-[2-chloro-2-(2,5-dimethylphenyl)ethyl]pyridine |
| SMILES | Cc1ccc(C)c(C(Cl)Cc2ccncc2Cl)c1 |
| InChI | InChI=1S/C15H15Cl2N/c1-10-3-4-11(2)13(7-10)14(16)8-12-5-6-18-9-15(12)17/h3-7,9,14H,8H2,1-2H3 |
| InChIKey | REPKEXRGLLGAHY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.20 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|