C14H21Cl2N — CID 112655993
3-chloro-4-(2-chloro-4,5,5-trimethylhexyl)pyridine (PubChem CID 112655993) has the molecular formula C14H21Cl2N and a molecular weight of 274.23 g/mol. Its IUPAC name is 3-chloro-4-(2-chloro-4,5,5-trimethylhexyl)pyridine.
| Compound Name | 3-chloro-4-(2-chloro-4,5,5-trimethylhexyl)pyridine |
|---|---|
| PubChem CID | 112655993 |
| Molecular Formula | C14H21Cl2N |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 3-chloro-4-(2-chloro-4,5,5-trimethylhexyl)pyridine |
| SMILES | CC(CC(Cl)Cc1ccncc1Cl)C(C)(C)C |
| InChI | InChI=1S/C14H21Cl2N/c1-10(14(2,3)4)7-12(15)8-11-5-6-17-9-13(11)16/h5-6,9-10,12H,7-8H2,1-4H3 |
| InChIKey | AQZUDVVWKYWAEP-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|