C16H33BO2 — CID 11265643
2-decyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 11265643) has the molecular formula C16H33BO2 and a molecular weight of 268.25 g/mol. Its IUPAC name is 2-decyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-decyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 11265643 |
| Molecular Formula | C16H33BO2 |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.26 |
| IUPAC Name | 2-decyl-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCCCCCCCCCB1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H33BO2/c1-6-7-8-9-10-11-12-13-14-17-18-15(2,3)16(4,5)19-17/h6-14H2,1-5H3 |
| InChIKey | HRMCLNRSAPIJDP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|