C13H20N2OS — CID 112656503
2-amino-N,5-dimethyl-N-(1-methylsulfanylpropan-2-yl)benzamide (PubChem CID 112656503) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-amino-N,5-dimethyl-N-(1-methylsulfanylpropan-2-yl)benzamide.
| Compound Name | 2-amino-N,5-dimethyl-N-(1-methylsulfanylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 112656503 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-amino-N,5-dimethyl-N-(1-methylsulfanylpropan-2-yl)benzamide |
| SMILES | CSCC(C)N(C)C(=O)c1cc(C)ccc1N |
| InChI | InChI=1S/C13H20N2OS/c1-9-5-6-12(14)11(7-9)13(16)15(3)10(2)8-17-4/h5-7,10H,8,14H2,1-4H3 |
| InChIKey | ORITWRFZYOWPAM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|