C12H19FN2S — CID 112657803
N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-N-methyl-2-methylsulfanylethanamine (PubChem CID 112657803) has the molecular formula C12H19FN2S and a molecular weight of 242.36 g/mol. Its IUPAC name is N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-N-methyl-2-methylsulfanylethanamine.
| Compound Name | N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-N-methyl-2-methylsulfanylethanamine |
|---|---|
| PubChem CID | 112657803 |
| Molecular Formula | C12H19FN2S |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | N-[[5-(aminomethyl)-2-fluorophenyl]methyl]-N-methyl-2-methylsulfanylethanamine |
| SMILES | CSCCN(C)Cc1cc(CN)ccc1F |
| InChI | InChI=1S/C12H19FN2S/c1-15(5-6-16-2)9-11-7-10(8-14)3-4-12(11)13/h3-4,7H,5-6,8-9,14H2,1-2H3 |
| InChIKey | NGTVTMXWVBJNPW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |