C16H25NOSi — CID 11265828
tert-butyl-dimethyl-[[(3R)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy]silane (PubChem CID 11265828) has the molecular formula C16H25NOSi and a molecular weight of 275.47 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3R)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3R)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy]silane |
|---|---|
| PubChem CID | 11265828 |
| Molecular Formula | C16H25NOSi |
| Molecular Weight | 275.47 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | tert-butyl-dimethyl-[[(3R)-5-phenyl-3,4-dihydro-2H-pyrrol-3-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CN=C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H25NOSi/c1-16(2,3)19(4,5)18-14-11-15(17-12-14)13-9-7-6-8-10-13/h6-10,14H,11-12H2,1-5H3/t14-/m1/s1 |
| InChIKey | ALVVLEVGSLUMTM-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.47 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|