C11H25N3OS — CID 112658549
4-amino-N-ethyl-3-[methyl(1-methylsulfanylpropan-2-yl)amino]butanamide (PubChem CID 112658549) has the molecular formula C11H25N3OS and a molecular weight of 247.41 g/mol. Its IUPAC name is 4-amino-N-ethyl-3-[methyl(1-methylsulfanylpropan-2-yl)amino]butanamide.
| Compound Name | 4-amino-N-ethyl-3-[methyl(1-methylsulfanylpropan-2-yl)amino]butanamide |
|---|---|
| PubChem CID | 112658549 |
| Molecular Formula | C11H25N3OS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 4-amino-N-ethyl-3-[methyl(1-methylsulfanylpropan-2-yl)amino]butanamide |
| SMILES | CCNC(=O)CC(CN)N(C)C(C)CSC |
| InChI | InChI=1S/C11H25N3OS/c1-5-13-11(15)6-10(7-12)14(3)9(2)8-16-4/h9-10H,5-8,12H2,1-4H3,(H,13,15) |
| InChIKey | QKVHHVZYWCJZFQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |