C17H24O3 — CID 11265857
(3R,4S,7S)-7-ethoxy-2,2,4,9-tetramethyl-6-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-ol (PubChem CID 11265857) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (3R,4S,7S)-7-ethoxy-2,2,4,9-tetramethyl-6-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-ol.
| Compound Name | (3R,4S,7S)-7-ethoxy-2,2,4,9-tetramethyl-6-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-ol |
|---|---|
| PubChem CID | 11265857 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (3R,4S,7S)-7-ethoxy-2,2,4,9-tetramethyl-6-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-3-ol |
| SMILES | CCO[C@H]1OC[C@]2(C)c3c(ccc(C)c31)C(C)(C)[C@H]2O |
| InChI | InChI=1S/C17H24O3/c1-6-19-14-12-10(2)7-8-11-13(12)17(5,9-20-14)15(18)16(11,3)4/h7-8,14-15,18H,6,9H2,1-5H3/t14-,15+,17+/m0/s1 |
| InChIKey | WVMUFKGZUAMWJW-ZMSDIMECSA-N |
| XLogP | 2.97 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |