C8H20N2OS — CID 112658794
1-amino-3-[methyl(1-methylsulfanylpropan-2-yl)amino]propan-2-ol (PubChem CID 112658794) has the molecular formula C8H20N2OS and a molecular weight of 192.33 g/mol. Its IUPAC name is 1-amino-3-[methyl(1-methylsulfanylpropan-2-yl)amino]propan-2-ol.
| Compound Name | 1-amino-3-[methyl(1-methylsulfanylpropan-2-yl)amino]propan-2-ol |
|---|---|
| PubChem CID | 112658794 |
| Molecular Formula | C8H20N2OS |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-amino-3-[methyl(1-methylsulfanylpropan-2-yl)amino]propan-2-ol |
| SMILES | CSCC(C)N(C)CC(O)CN |
| InChI | InChI=1S/C8H20N2OS/c1-7(6-12-3)10(2)5-8(11)4-9/h7-8,11H,4-6,9H2,1-3H3 |
| InChIKey | SFGYSFNWDNZYDH-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |