C13H18N2OS2 — CID 112659614
2-(4-carbamothioylphenyl)-N-methyl-N-(2-methylsulfanylethyl)acetamide (PubChem CID 112659614) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 2-(4-carbamothioylphenyl)-N-methyl-N-(2-methylsulfanylethyl)acetamide.
| Compound Name | 2-(4-carbamothioylphenyl)-N-methyl-N-(2-methylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 112659614 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(4-carbamothioylphenyl)-N-methyl-N-(2-methylsulfanylethyl)acetamide |
| SMILES | CSCCN(C)C(=O)Cc1ccc(C(N)=S)cc1 |
| InChI | InChI=1S/C13H18N2OS2/c1-15(7-8-18-2)12(16)9-10-3-5-11(6-4-10)13(14)17/h3-6H,7-9H2,1-2H3,(H2,14,17) |
| InChIKey | YQQRMHFEQZRISK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|