C13H24N2OS2 — CID 112659640
1-carbamothioyl-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)cyclobutane-1-carboxamide (PubChem CID 112659640) has the molecular formula C13H24N2OS2 and a molecular weight of 288.48 g/mol. Its IUPAC name is 1-carbamothioyl-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)cyclobutane-1-carboxamide.
| Compound Name | 1-carbamothioyl-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 112659640 |
| Molecular Formula | C13H24N2OS2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 1-carbamothioyl-N,3-dimethyl-N-(1-methylsulfanylbutan-2-yl)cyclobutane-1-carboxamide |
| SMILES | CCC(CSC)N(C)C(=O)C1(C(N)=S)CC(C)C1 |
| InChI | InChI=1S/C13H24N2OS2/c1-5-10(8-18-4)15(3)12(16)13(11(14)17)6-9(2)7-13/h9-10H,5-8H2,1-4H3,(H2,14,17) |
| InChIKey | SUCYMZVMKSFCOP-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|