About (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline
(2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline (PubChem CID 11265995) has the molecular formula C17H13ClN2
and a molecular weight of 280.76 g/mol. Its IUPAC name is (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline.
Molecular Properties
| Compound Name | (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline |
| PubChem CID | 11265995 |
| Molecular Formula | C17H13ClN2 |
| Molecular Weight | 280.76 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline |
| SMILES | Clc1ccc2c(c1)C=CC1=N[C@H](c3ccccc3)CN12 |
| InChI | InChI=1S/C17H13ClN2/c18-14-7-8-16-13(10-14)6-9-17-19-15(11-20(16)17)12-4-2-1-3-5-12/h1-10,15H,11H2/t15-/m0/s1 |
| InChIKey | NSDHWNIPOSKHPE-HNNXBMFYSA-N |
| XLogP | 4.33 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.76 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline?
The IUPAC name of (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline (CID 11265995) is (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline.
What is the SMILES notation for (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline?
The canonical SMILES for (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline is Clc1ccc2c(c1)C=CC1=N[C@H](c3ccccc3)CN12.
What is the InChIKey of (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline?
The InChIKey is NSDHWNIPOSKHPE-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H13ClN2/c18-14-7-8-16-13(10-14)6-9-17-19-15(11-20(16)17)12-4-2-1-3-5-12/h1-10,15H,11H2/t15-/m0/s1.
What are the key properties of (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline?
(2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline has a molecular weight of 280.76 g/mol, XLogP of 4.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-7-chloro-2-phenyl-1,2-dihydroimidazo[1,2-a]quinoline is sourced from PubChem (CID 11265995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).