About 2-hydroxybutanoic acid
2-hydroxybutanoic acid (PubChem CID 11266) has the molecular formula C4H8O3
and a molecular weight of 104.10 g/mol. Its IUPAC name is 2-hydroxybutanoic acid.
Molecular Properties
| Compound Name | 2-hydroxybutanoic acid |
| PubChem CID | 11266 |
| Molecular Formula | C4H8O3 |
| Molecular Weight | 104.10 g/mol |
| Exact Mass | 104.05 |
| IUPAC Name | 2-hydroxybutanoic acid |
| SMILES | CCC(O)C(=O)O |
| InChI | InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7) |
| InChIKey | AFENDNXGAFYKQO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.10 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-hydroxybutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybutanoic acid?
The IUPAC name of 2-hydroxybutanoic acid (CID 11266) is 2-hydroxybutanoic acid.
What is the SMILES notation for 2-hydroxybutanoic acid?
The canonical SMILES for 2-hydroxybutanoic acid is CCC(O)C(=O)O.
What is the InChIKey of 2-hydroxybutanoic acid?
The InChIKey is AFENDNXGAFYKQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3/c1-2-3(5)4(6)7/h3,5H,2H2,1H3,(H,6,7).
What are the key properties of 2-hydroxybutanoic acid?
2-hydroxybutanoic acid has a molecular weight of 104.10 g/mol, XLogP of -0.16, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybutanoic acid is sourced from PubChem (CID 11266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).