C15H22O5 — CID 11266040
(2S,3S,4aR,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-5-prop-2-enyl-5,8a-dihydro-4aH-1,4-benzodioxin-6-one (PubChem CID 11266040) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is (2S,3S,4aR,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-5-prop-2-enyl-5,8a-dihydro-4aH-1,4-benzodioxin-6-one.
| Compound Name | (2S,3S,4aR,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-5-prop-2-enyl-5,8a-dihydro-4aH-1,4-benzodioxin-6-one |
|---|---|
| PubChem CID | 11266040 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | (2S,3S,4aR,5R,8aR)-2,3-dimethoxy-2,3-dimethyl-5-prop-2-enyl-5,8a-dihydro-4aH-1,4-benzodioxin-6-one |
| SMILES | C=CC[C@H]1C(=O)C=C[C@H]2O[C@](C)(OC)[C@@](C)(OC)O[C@@H]21 |
| InChI | InChI=1S/C15H22O5/c1-6-7-10-11(16)8-9-12-13(10)20-15(3,18-5)14(2,17-4)19-12/h6,8-10,12-13H,1,7H2,2-5H3/t10-,12+,13+,14-,15-/m0/s1 |
| InChIKey | RCORWTXMUXGBMP-YADOHIMWSA-N |
| XLogP | 1.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|