C15H25BrN2S — CID 112660554
2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(1-methylsulfanylbutan-2-yl)aniline (PubChem CID 112660554) has the molecular formula C15H25BrN2S and a molecular weight of 345.35 g/mol. Its IUPAC name is 2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(1-methylsulfanylbutan-2-yl)aniline.
| Compound Name | 2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(1-methylsulfanylbutan-2-yl)aniline |
|---|---|
| PubChem CID | 112660554 |
| Molecular Formula | C15H25BrN2S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-bromo-N-methyl-4-[1-(methylamino)ethyl]-N-(1-methylsulfanylbutan-2-yl)aniline |
| SMILES | CCC(CSC)N(C)c1ccc(C(C)NC)cc1Br |
| InChI | InChI=1S/C15H25BrN2S/c1-6-13(10-19-5)18(4)15-8-7-12(9-14(15)16)11(2)17-3/h7-9,11,13,17H,6,10H2,1-5H3 |
| InChIKey | NXCUNEZUHIDZNR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|