C10H18N2O4S — CID 112661372
4-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]-4-oxobutanoic acid (PubChem CID 112661372) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is 4-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 112661372 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 4-[[methyl(1-methylsulfanylpropan-2-yl)carbamoyl]amino]-4-oxobutanoic acid |
| SMILES | CSCC(C)N(C)C(=O)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C10H18N2O4S/c1-7(6-17-3)12(2)10(16)11-8(13)4-5-9(14)15/h7H,4-6H2,1-3H3,(H,14,15)(H,11,13,16) |
| InChIKey | RJFGROAZPLIWAY-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |