C13H17BrN2O2S — CID 112661806
5-bromo-3-hydroxy-6-[methyl(1-methylsulfanylpropan-2-yl)amino]-1,3-dihydroindol-2-one (PubChem CID 112661806) has the molecular formula C13H17BrN2O2S and a molecular weight of 345.26 g/mol. Its IUPAC name is 5-bromo-3-hydroxy-6-[methyl(1-methylsulfanylpropan-2-yl)amino]-1,3-dihydroindol-2-one.
| Compound Name | 5-bromo-3-hydroxy-6-[methyl(1-methylsulfanylpropan-2-yl)amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 112661806 |
| Molecular Formula | C13H17BrN2O2S |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.02 |
| IUPAC Name | 5-bromo-3-hydroxy-6-[methyl(1-methylsulfanylpropan-2-yl)amino]-1,3-dihydroindol-2-one |
| SMILES | CSCC(C)N(C)c1cc2c(cc1Br)C(O)C(=O)N2 |
| InChI | InChI=1S/C13H17BrN2O2S/c1-7(6-19-3)16(2)11-5-10-8(4-9(11)14)12(17)13(18)15-10/h4-5,7,12,17H,6H2,1-3H3,(H,15,18) |
| InChIKey | KJHUTJSQEUFIEZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|