C14H19NO2S2 — CID 112663407
3-(3-hydroxyprop-1-ynyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-carboxamide (PubChem CID 112663407) has the molecular formula C14H19NO2S2 and a molecular weight of 297.45 g/mol. Its IUPAC name is 3-(3-hydroxyprop-1-ynyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-(3-hydroxyprop-1-ynyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 112663407 |
| Molecular Formula | C14H19NO2S2 |
| Molecular Weight | 297.45 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 3-(3-hydroxyprop-1-ynyl)-N-methyl-N-(1-methylsulfanylbutan-2-yl)thiophene-2-carboxamide |
| SMILES | CCC(CSC)N(C)C(=O)c1sccc1C#CCO |
| InChI | InChI=1S/C14H19NO2S2/c1-4-12(10-18-3)15(2)14(17)13-11(6-5-8-16)7-9-19-13/h7,9,12,16H,4,8,10H2,1-3H3 |
| InChIKey | MFVZMJQKGKBAIO-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|