About 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine
5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine (PubChem CID 112663613) has the molecular formula C11H17ClN2S
and a molecular weight of 244.79 g/mol. Its IUPAC name is 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine.
Molecular Properties
| Compound Name | 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine |
| PubChem CID | 112663613 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine |
| SMILES | CSCCN(C)c1cc(C)ncc1CCl |
| InChI | InChI=1S/C11H17ClN2S/c1-9-6-11(10(7-12)8-13-9)14(2)4-5-15-3/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | QFTIAQWMBOLOFX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine?
The IUPAC name of 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine (CID 112663613) is 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine.
What is the SMILES notation for 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine?
The canonical SMILES for 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine is CSCCN(C)c1cc(C)ncc1CCl.
What is the InChIKey of 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine?
The InChIKey is QFTIAQWMBOLOFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2S/c1-9-6-11(10(7-12)8-13-9)14(2)4-5-15-3/h6,8H,4-5,7H2,1-3H3.
What are the key properties of 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine?
5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine has a molecular weight of 244.79 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(chloromethyl)-N,2-dimethyl-N-(2-methylsulfanylethyl)pyridin-4-amine is sourced from PubChem (CID 112663613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).