C14H23N3OS — CID 112664197
N-methyl-N-(1-methylsulfanylpropan-2-yl)-6-(propylamino)pyridine-2-carboxamide (PubChem CID 112664197) has the molecular formula C14H23N3OS and a molecular weight of 281.43 g/mol. Its IUPAC name is N-methyl-N-(1-methylsulfanylpropan-2-yl)-6-(propylamino)pyridine-2-carboxamide.
| Compound Name | N-methyl-N-(1-methylsulfanylpropan-2-yl)-6-(propylamino)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 112664197 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-methyl-N-(1-methylsulfanylpropan-2-yl)-6-(propylamino)pyridine-2-carboxamide |
| SMILES | CCCNc1cccc(C(=O)N(C)C(C)CSC)n1 |
| InChI | InChI=1S/C14H23N3OS/c1-5-9-15-13-8-6-7-12(16-13)14(18)17(3)11(2)10-19-4/h6-8,11H,5,9-10H2,1-4H3,(H,15,16) |
| InChIKey | WYAUCUADGDEYJG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |