C17H25ClO2 — CID 11266464
2-(4-chlorobutyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol (PubChem CID 11266464) has the molecular formula C17H25ClO2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-(4-chlorobutyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol.
| Compound Name | 2-(4-chlorobutyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
|---|---|
| PubChem CID | 11266464 |
| Molecular Formula | C17H25ClO2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 2-(4-chlorobutyl)-2,5,7,8-tetramethyl-3,4-dihydrochromen-6-ol |
| SMILES | Cc1c(C)c2c(c(C)c1O)CCC(C)(CCCCCl)O2 |
| InChI | InChI=1S/C17H25ClO2/c1-11-12(2)16-14(13(3)15(11)19)7-9-17(4,20-16)8-5-6-10-18/h19H,5-10H2,1-4H3 |
| InChIKey | ZWQOQSUFFQYJKO-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|