C10H16ClN3S — CID 112665201
5-(aminomethyl)-3-chloro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine (PubChem CID 112665201) has the molecular formula C10H16ClN3S and a molecular weight of 245.78 g/mol. Its IUPAC name is 5-(aminomethyl)-3-chloro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine.
| Compound Name | 5-(aminomethyl)-3-chloro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 112665201 |
| Molecular Formula | C10H16ClN3S |
| Molecular Weight | 245.78 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 5-(aminomethyl)-3-chloro-N-methyl-N-(2-methylsulfanylethyl)pyridin-2-amine |
| SMILES | CSCCN(C)c1ncc(CN)cc1Cl |
| InChI | InChI=1S/C10H16ClN3S/c1-14(3-4-15-2)10-9(11)5-8(6-12)7-13-10/h5,7H,3-4,6,12H2,1-2H3 |
| InChIKey | XGGCKBDTIGHZPB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.78 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |