C13H27N5S — CID 112665709
N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-methyl-1-methylsulfanylbutan-2-amine (PubChem CID 112665709) has the molecular formula C13H27N5S and a molecular weight of 285.46 g/mol. Its IUPAC name is N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-methyl-1-methylsulfanylbutan-2-amine.
| Compound Name | N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-methyl-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 112665709 |
| Molecular Formula | C13H27N5S |
| Molecular Weight | 285.46 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | N-[2-[4-(ethylaminomethyl)triazol-1-yl]ethyl]-N-methyl-1-methylsulfanylbutan-2-amine |
| SMILES | CCNCc1cn(CCN(C)C(CC)CSC)nn1 |
| InChI | InChI=1S/C13H27N5S/c1-5-13(11-19-4)17(3)7-8-18-10-12(15-16-18)9-14-6-2/h10,13-14H,5-9,11H2,1-4H3 |
| InChIKey | LLODERNIKKMUIB-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |