C13H24N2OS — CID 112665767
N-methyl-N-[[4-(methylaminomethyl)furan-2-yl]methyl]-1-methylsulfanylbutan-2-amine (PubChem CID 112665767) has the molecular formula C13H24N2OS and a molecular weight of 256.41 g/mol. Its IUPAC name is N-methyl-N-[[4-(methylaminomethyl)furan-2-yl]methyl]-1-methylsulfanylbutan-2-amine.
| Compound Name | N-methyl-N-[[4-(methylaminomethyl)furan-2-yl]methyl]-1-methylsulfanylbutan-2-amine |
|---|---|
| PubChem CID | 112665767 |
| Molecular Formula | C13H24N2OS |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | N-methyl-N-[[4-(methylaminomethyl)furan-2-yl]methyl]-1-methylsulfanylbutan-2-amine |
| SMILES | CCC(CSC)N(C)Cc1cc(CNC)co1 |
| InChI | InChI=1S/C13H24N2OS/c1-5-12(10-17-4)15(3)8-13-6-11(7-14-2)9-16-13/h6,9,12,14H,5,7-8,10H2,1-4H3 |
| InChIKey | AXOFQXFXXXKUTK-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |