C18H22O4 — CID 11266629
2,2-dimethyl-5-(1-phenylcyclohexyl)-1,3-dioxane-4,6-dione (PubChem CID 11266629) has the molecular formula C18H22O4 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2,2-dimethyl-5-(1-phenylcyclohexyl)-1,3-dioxane-4,6-dione.
| Compound Name | 2,2-dimethyl-5-(1-phenylcyclohexyl)-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 11266629 |
| Molecular Formula | C18H22O4 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | 2,2-dimethyl-5-(1-phenylcyclohexyl)-1,3-dioxane-4,6-dione |
| SMILES | CC1(C)OC(=O)C(C2(c3ccccc3)CCCCC2)C(=O)O1 |
| InChI | InChI=1S/C18H22O4/c1-17(2)21-15(19)14(16(20)22-17)18(11-7-4-8-12-18)13-9-5-3-6-10-13/h3,5-6,9-10,14H,4,7-8,11-12H2,1-2H3 |
| InChIKey | MPMYDOTWMIDWDC-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|