C12H21N3S2 — CID 112666317
2-N,7-N-dimethyl-2-N-(2-methylsulfanylethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine (PubChem CID 112666317) has the molecular formula C12H21N3S2 and a molecular weight of 271.45 g/mol. Its IUPAC name is 2-N,7-N-dimethyl-2-N-(2-methylsulfanylethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine.
| Compound Name | 2-N,7-N-dimethyl-2-N-(2-methylsulfanylethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
|---|---|
| PubChem CID | 112666317 |
| Molecular Formula | C12H21N3S2 |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 2-N,7-N-dimethyl-2-N-(2-methylsulfanylethyl)-4,5,6,7-tetrahydro-1,3-benzothiazole-2,7-diamine |
| SMILES | CNC1CCCc2nc(N(C)CCSC)sc21 |
| InChI | InChI=1S/C12H21N3S2/c1-13-9-5-4-6-10-11(9)17-12(14-10)15(2)7-8-16-3/h9,13H,4-8H2,1-3H3 |
| InChIKey | OJQQQDQVGNOMNG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |