C18H30Si2 — CID 11266643
trimethyl-[(1S,2R,3S)-3-methyl-1-phenyl-2-propan-2-yl-3,6-dihydro-2H-silin-1-yl]silane (PubChem CID 11266643) has the molecular formula C18H30Si2 and a molecular weight of 302.61 g/mol. Its IUPAC name is trimethyl-[(1S,2R,3S)-3-methyl-1-phenyl-2-propan-2-yl-3,6-dihydro-2H-silin-1-yl]silane.
| Compound Name | trimethyl-[(1S,2R,3S)-3-methyl-1-phenyl-2-propan-2-yl-3,6-dihydro-2H-silin-1-yl]silane |
|---|---|
| PubChem CID | 11266643 |
| Molecular Formula | C18H30Si2 |
| Molecular Weight | 302.61 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | trimethyl-[(1S,2R,3S)-3-methyl-1-phenyl-2-propan-2-yl-3,6-dihydro-2H-silin-1-yl]silane |
| SMILES | CC(C)[C@@H]1[C@@H](C)C=CC[Si@]1(c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C18H30Si2/c1-15(2)18-16(3)11-10-14-20(18,19(4,5)6)17-12-8-7-9-13-17/h7-13,15-16,18H,14H2,1-6H3/t16-,18+,20+/m0/s1 |
| InChIKey | YFTUFMFBRPLITN-ILZDJORESA-N |
| XLogP | 4.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|