About (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one
(1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one (PubChem CID 11266676) has the molecular formula C14H24O7
and a molecular weight of 304.34 g/mol. Its IUPAC name is (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one.
Molecular Properties
| Compound Name | (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one |
| PubChem CID | 11266676 |
| Molecular Formula | C14H24O7 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one |
| SMILES | CCOC1(OCC)C[C@H]2C(=O)OC[C@]21OCOCCOC |
| InChI | InChI=1S/C14H24O7/c1-4-19-14(20-5-2)8-11-12(15)18-9-13(11,14)21-10-17-7-6-16-3/h11H,4-10H2,1-3H3/t11-,13-/m0/s1 |
| InChIKey | LWRRGTXYVLMTCD-AAEUAGOBSA-N |
| XLogP | 0.71 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one?
The IUPAC name of (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one (CID 11266676) is (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one.
What is the SMILES notation for (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one?
The canonical SMILES for (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one is CCOC1(OCC)C[C@H]2C(=O)OC[C@]21OCOCCOC.
What is the InChIKey of (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one?
The InChIKey is LWRRGTXYVLMTCD-AAEUAGOBSA-N. The full InChI is InChI=1S/C14H24O7/c1-4-19-14(20-5-2)8-11-12(15)18-9-13(11,14)21-10-17-7-6-16-3/h11H,4-10H2,1-3H3/t11-,13-/m0/s1.
What are the key properties of (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one?
(1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one has a molecular weight of 304.34 g/mol, XLogP of 0.71, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,5R)-6,6-diethoxy-5-(2-methoxyethoxymethoxy)-3-oxabicyclo[3.2.0]heptan-2-one is sourced from PubChem (CID 11266676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).