C18H28O2Si — CID 11266708
(2R,3S,5Z,8R)-8-[(E)-prop-1-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol (PubChem CID 11266708) has the molecular formula C18H28O2Si and a molecular weight of 304.51 g/mol. Its IUPAC name is (2R,3S,5Z,8R)-8-[(E)-prop-1-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol.
| Compound Name | (2R,3S,5Z,8R)-8-[(E)-prop-1-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol |
|---|---|
| PubChem CID | 11266708 |
| Molecular Formula | C18H28O2Si |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (2R,3S,5Z,8R)-8-[(E)-prop-1-enyl]-2-[(E)-5-trimethylsilylpent-2-en-4-ynyl]-3,4,7,8-tetrahydro-2H-oxocin-3-ol |
| SMILES | C/C=C/[C@H]1C/C=C\C[C@H](O)[C@@H](C/C=C/C#C[Si](C)(C)C)O1 |
| InChI | InChI=1S/C18H28O2Si/c1-5-11-16-12-8-9-13-17(19)18(20-16)14-7-6-10-15-21(2,3)4/h5-9,11,16-19H,12-14H2,1-4H3/b7-6+,9-8-,11-5+/t16-,17-,18+/m0/s1 |
| InChIKey | FCVGHOOAYJQUAZ-QYHNMRLVSA-N |
| XLogP | 3.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|