C9H18N4O2S2 — CID 112667312
1-(2-aminoethyl)-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide (PubChem CID 112667312) has the molecular formula C9H18N4O2S2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1-(2-aminoethyl)-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide.
| Compound Name | 1-(2-aminoethyl)-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 112667312 |
| Molecular Formula | C9H18N4O2S2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(2-aminoethyl)-N-methyl-N-(2-methylsulfanylethyl)pyrazole-4-sulfonamide |
| SMILES | CSCCN(C)S(=O)(=O)c1cnn(CCN)c1 |
| InChI | InChI=1S/C9H18N4O2S2/c1-12(5-6-16-2)17(14,15)9-7-11-13(8-9)4-3-10/h7-8H,3-6,10H2,1-2H3 |
| InChIKey | XTTSQPLSCSPQDL-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |