About 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine
4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine (PubChem CID 112667653) has the molecular formula C8H14N4S
and a molecular weight of 198.30 g/mol. Its IUPAC name is 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine |
| PubChem CID | 112667653 |
| Molecular Formula | C8H14N4S |
| Molecular Weight | 198.30 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine |
| SMILES | CSCCN(C)c1ccnc(N)n1 |
| InChI | InChI=1S/C8H14N4S/c1-12(5-6-13-2)7-3-4-10-8(9)11-7/h3-4H,5-6H2,1-2H3,(H2,9,10,11) |
| InChIKey | VRKJOEFLGUGOOJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.30 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine?
The IUPAC name of 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine (CID 112667653) is 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine is CSCCN(C)c1ccnc(N)n1.
What is the InChIKey of 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine?
The InChIKey is VRKJOEFLGUGOOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4S/c1-12(5-6-13-2)7-3-4-10-8(9)11-7/h3-4H,5-6H2,1-2H3,(H2,9,10,11).
What are the key properties of 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine?
4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine has a molecular weight of 198.30 g/mol, XLogP of 0.86, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-methyl-4-N-(2-methylsulfanylethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 112667653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).