C13H14FN3O — CID 112668766
N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-fluorobenzamide (PubChem CID 112668766) has the molecular formula C13H14FN3O and a molecular weight of 247.27 g/mol. Its IUPAC name is N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-fluorobenzamide.
| Compound Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 112668766 |
| Molecular Formula | C13H14FN3O |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | N-[(1,3-dimethylpyrazol-4-yl)methyl]-2-fluorobenzamide |
| SMILES | Cc1nn(C)cc1CNC(=O)c1ccccc1F |
| InChI | InChI=1S/C13H14FN3O/c1-9-10(8-17(2)16-9)7-15-13(18)11-5-3-4-6-12(11)14/h3-6,8H,7H2,1-2H3,(H,15,18) |
| InChIKey | XIJYOELRIUAIRI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |