C16H14N4OS — CID 11266891
4-[(2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-yl)amino]phenol (PubChem CID 11266891) has the molecular formula C16H14N4OS and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[(2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-yl)amino]phenol.
| Compound Name | 4-[(2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-yl)amino]phenol |
|---|---|
| PubChem CID | 11266891 |
| Molecular Formula | C16H14N4OS |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-[(2-methyl-4,5-dihydro-[1,3]thiazolo[4,5-h]quinazolin-8-yl)amino]phenol |
| SMILES | Cc1nc2c(s1)-c1nc(Nc3ccc(O)cc3)ncc1CC2 |
| InChI | InChI=1S/C16H14N4OS/c1-9-18-13-7-2-10-8-17-16(20-14(10)15(13)22-9)19-11-3-5-12(21)6-4-11/h3-6,8,21H,2,7H2,1H3,(H,17,19,20) |
| InChIKey | UZIOINNWQLHWHQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|