C19H24O4 — CID 11267064
(E)-3-[(3S)-4,4-dimethyl-3-(3-methylbut-2-enoxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]prop-2-enal (PubChem CID 11267064) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is (E)-3-[(3S)-4,4-dimethyl-3-(3-methylbut-2-enoxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]prop-2-enal.
| Compound Name | (E)-3-[(3S)-4,4-dimethyl-3-(3-methylbut-2-enoxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]prop-2-enal |
|---|---|
| PubChem CID | 11267064 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (E)-3-[(3S)-4,4-dimethyl-3-(3-methylbut-2-enoxy)-2,3-dihydro-1,5-benzodioxepin-7-yl]prop-2-enal |
| SMILES | CC(C)=CCO[C@H]1COc2ccc(/C=C/C=O)cc2OC1(C)C |
| InChI | InChI=1S/C19H24O4/c1-14(2)9-11-21-18-13-22-16-8-7-15(6-5-10-20)12-17(16)23-19(18,3)4/h5-10,12,18H,11,13H2,1-4H3/b6-5+/t18-/m0/s1 |
| InChIKey | KYZNGNPVABVNKB-QWNKOJSDSA-N |
| XLogP | 3.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|