C8H12F2N2O — CID 112670831
1-(3-ethyl-1-methylpyrazol-4-yl)-2,2-difluoroethanol (PubChem CID 112670831) has the molecular formula C8H12F2N2O and a molecular weight of 190.19 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylpyrazol-4-yl)-2,2-difluoroethanol.
| Compound Name | 1-(3-ethyl-1-methylpyrazol-4-yl)-2,2-difluoroethanol |
|---|---|
| PubChem CID | 112670831 |
| Molecular Formula | C8H12F2N2O |
| Molecular Weight | 190.19 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 1-(3-ethyl-1-methylpyrazol-4-yl)-2,2-difluoroethanol |
| SMILES | CCc1nn(C)cc1C(O)C(F)F |
| InChI | InChI=1S/C8H12F2N2O/c1-3-6-5(4-12(2)11-6)7(13)8(9)10/h4,7-8,13H,3H2,1-2H3 |
| InChIKey | BQKGQOFDDJQEQI-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.19 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |