C11H17FN2O3 — CID 112671105
ethyl 3-(3-ethyl-1-methylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate (PubChem CID 112671105) has the molecular formula C11H17FN2O3 and a molecular weight of 244.27 g/mol. Its IUPAC name is ethyl 3-(3-ethyl-1-methylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate.
| Compound Name | ethyl 3-(3-ethyl-1-methylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate |
|---|---|
| PubChem CID | 112671105 |
| Molecular Formula | C11H17FN2O3 |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | ethyl 3-(3-ethyl-1-methylpyrazol-4-yl)-2-fluoro-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(F)C(O)c1cn(C)nc1CC |
| InChI | InChI=1S/C11H17FN2O3/c1-4-8-7(6-14(3)13-8)10(15)9(12)11(16)17-5-2/h6,9-10,15H,4-5H2,1-3H3 |
| InChIKey | ZRMREQXLXKBYLI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |