C17H18O6 — CID 11267116
(4R,5R)-4-hydroxy-5-(1,4,5-trimethoxynaphthalen-2-yl)oxolan-2-one (PubChem CID 11267116) has the molecular formula C17H18O6 and a molecular weight of 318.33 g/mol. Its IUPAC name is (4R,5R)-4-hydroxy-5-(1,4,5-trimethoxynaphthalen-2-yl)oxolan-2-one.
| Compound Name | (4R,5R)-4-hydroxy-5-(1,4,5-trimethoxynaphthalen-2-yl)oxolan-2-one |
|---|---|
| PubChem CID | 11267116 |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (4R,5R)-4-hydroxy-5-(1,4,5-trimethoxynaphthalen-2-yl)oxolan-2-one |
| SMILES | COc1c([C@H]2OC(=O)C[C@H]2O)cc(OC)c2c(OC)cccc12 |
| InChI | InChI=1S/C17H18O6/c1-20-12-6-4-5-9-15(12)13(21-2)7-10(16(9)22-3)17-11(18)8-14(19)23-17/h4-7,11,17-18H,8H2,1-3H3/t11-,17-/m1/s1 |
| InChIKey | CUKJILGDVCWXLG-PIGZYNQJSA-N |
| XLogP | 2.21 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |