C16H16O5S — CID 11267174
4-(5,7-dimethoxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol (PubChem CID 11267174) has the molecular formula C16H16O5S and a molecular weight of 320.37 g/mol. Its IUPAC name is 4-(5,7-dimethoxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol.
| Compound Name | 4-(5,7-dimethoxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 11267174 |
| Molecular Formula | C16H16O5S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | 4-(5,7-dimethoxy-2,3-dihydro-1,4-benzoxathiin-2-yl)benzene-1,2-diol |
| SMILES | COc1cc(OC)c2c(c1)OC(c1ccc(O)c(O)c1)CS2 |
| InChI | InChI=1S/C16H16O5S/c1-19-10-6-13(20-2)16-14(7-10)21-15(8-22-16)9-3-4-11(17)12(18)5-9/h3-7,15,17-18H,8H2,1-2H3 |
| InChIKey | XYPFLFRBRGMQGR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|