C16H18ClFN4 — CID 11267189
4-[4-(4-chlorophenyl)piperazin-1-yl]-5-fluorobenzene-1,2-diamine (PubChem CID 11267189) has the molecular formula C16H18ClFN4 and a molecular weight of 320.80 g/mol. Its IUPAC name is 4-[4-(4-chlorophenyl)piperazin-1-yl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 4-[4-(4-chlorophenyl)piperazin-1-yl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 11267189 |
| Molecular Formula | C16H18ClFN4 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 4-[4-(4-chlorophenyl)piperazin-1-yl]-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)c(N2CCN(c3ccc(Cl)cc3)CC2)cc1N |
| InChI | InChI=1S/C16H18ClFN4/c17-11-1-3-12(4-2-11)21-5-7-22(8-6-21)16-10-15(20)14(19)9-13(16)18/h1-4,9-10H,5-8,19-20H2 |
| InChIKey | VUAPJFCNCPQKJY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|