C18H19N5O — CID 11267201
6-(3-cyclohexylprop-1-ynyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine (PubChem CID 11267201) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-(3-cyclohexylprop-1-ynyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine.
| Compound Name | 6-(3-cyclohexylprop-1-ynyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 11267201 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 6-(3-cyclohexylprop-1-ynyl)-2-(furan-2-yl)-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
| SMILES | Nc1nc(C#CCC2CCCCC2)cn2nc(-c3ccco3)nc12 |
| InChI | InChI=1S/C18H19N5O/c19-16-18-21-17(15-10-5-11-24-15)22-23(18)12-14(20-16)9-4-8-13-6-2-1-3-7-13/h5,10-13H,1-3,6-8H2,(H2,19,20) |
| InChIKey | BNOJPYWGZKJFRQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 82.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|