C13H17F7O — CID 11267226
(E)-1,1,1,2,2,3,4-heptafluorotridec-3-en-5-one (PubChem CID 11267226) has the molecular formula C13H17F7O and a molecular weight of 322.26 g/mol. Its IUPAC name is (E)-1,1,1,2,2,3,4-heptafluorotridec-3-en-5-one.
| Compound Name | (E)-1,1,1,2,2,3,4-heptafluorotridec-3-en-5-one |
|---|---|
| PubChem CID | 11267226 |
| Molecular Formula | C13H17F7O |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (E)-1,1,1,2,2,3,4-heptafluorotridec-3-en-5-one |
| SMILES | CCCCCCCCC(=O)/C(F)=C(\F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H17F7O/c1-2-3-4-5-6-7-8-9(21)10(14)11(15)12(16,17)13(18,19)20/h2-8H2,1H3/b11-10+ |
| InChIKey | WSRIBRLBBNSKIL-ZHACJKMWSA-N |
| XLogP | 5.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|