C8H14N2O5 — CID 112672362
4-[(2-amino-2-oxoethoxy)amino]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 112672362) has the molecular formula C8H14N2O5 and a molecular weight of 218.21 g/mol. Its IUPAC name is 4-[(2-amino-2-oxoethoxy)amino]-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-[(2-amino-2-oxoethoxy)amino]-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 112672362 |
| Molecular Formula | C8H14N2O5 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 4-[(2-amino-2-oxoethoxy)amino]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)NOCC(N)=O)C(=O)O |
| InChI | InChI=1S/C8H14N2O5/c1-8(2,7(13)14)3-6(12)10-15-4-5(9)11/h3-4H2,1-2H3,(H2,9,11)(H,10,12)(H,13,14) |
| InChIKey | YTBMKQGENQJCLG-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|