C9H10Cl2N2O2 — CID 112672702
2-[(3,5-dichlorophenyl)methylamino]oxyacetamide (PubChem CID 112672702) has the molecular formula C9H10Cl2N2O2 and a molecular weight of 249.10 g/mol. Its IUPAC name is 2-[(3,5-dichlorophenyl)methylamino]oxyacetamide.
| Compound Name | 2-[(3,5-dichlorophenyl)methylamino]oxyacetamide |
|---|---|
| PubChem CID | 112672702 |
| Molecular Formula | C9H10Cl2N2O2 |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 248.01 |
| IUPAC Name | 2-[(3,5-dichlorophenyl)methylamino]oxyacetamide |
| SMILES | NC(=O)CONCc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H10Cl2N2O2/c10-7-1-6(2-8(11)3-7)4-13-15-5-9(12)14/h1-3,13H,4-5H2,(H2,12,14) |
| InChIKey | BYNOSHRUMXVCDQ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|