C10H15N3O4S — CID 112673453
2-[[benzyl(methyl)sulfamoyl]amino]oxyacetamide (PubChem CID 112673453) has the molecular formula C10H15N3O4S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[[benzyl(methyl)sulfamoyl]amino]oxyacetamide.
| Compound Name | 2-[[benzyl(methyl)sulfamoyl]amino]oxyacetamide |
|---|---|
| PubChem CID | 112673453 |
| Molecular Formula | C10H15N3O4S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-[[benzyl(methyl)sulfamoyl]amino]oxyacetamide |
| SMILES | CN(Cc1ccccc1)S(=O)(=O)NOCC(N)=O |
| InChI | InChI=1S/C10H15N3O4S/c1-13(7-9-5-3-2-4-6-9)18(15,16)12-17-8-10(11)14/h2-6,12H,7-8H2,1H3,(H2,11,14) |
| InChIKey | WEOQVAZKHKPZMZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|