C7H12N4O4S — CID 112673463
2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]oxyacetamide (PubChem CID 112673463) has the molecular formula C7H12N4O4S and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]oxyacetamide.
| Compound Name | 2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]oxyacetamide |
|---|---|
| PubChem CID | 112673463 |
| Molecular Formula | C7H12N4O4S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-[(2-ethyl-1H-imidazol-5-yl)sulfonylamino]oxyacetamide |
| SMILES | CCc1ncc(S(=O)(=O)NOCC(N)=O)[nH]1 |
| InChI | InChI=1S/C7H12N4O4S/c1-2-6-9-3-7(10-6)16(13,14)11-15-4-5(8)12/h3,11H,2,4H2,1H3,(H2,8,12)(H,9,10) |
| InChIKey | IYVRGHHLRZLAFG-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|