About N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide
N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide (PubChem CID 11267385) has the molecular formula C17H16ClN4O+
and a molecular weight of 327.80 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide.
Molecular Properties
| Compound Name | N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide |
| PubChem CID | 11267385 |
| Molecular Formula | C17H16ClN4O+ |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide |
| SMILES | Cc1nn(-c2ccc(Cl)cc2)[n+](NC(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C17H15ClN4O/c1-12-13(2)21(20-17(23)14-6-4-3-5-7-14)22(19-12)16-10-8-15(18)9-11-16/h3-11H,1-2H3/p+1 |
| InChIKey | HDHWXZDVIZMKFM-UHFFFAOYSA-O |
| XLogP | 2.81 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide?
The IUPAC name of N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide (CID 11267385) is N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide.
What is the SMILES notation for N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide?
The canonical SMILES for N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide is Cc1nn(-c2ccc(Cl)cc2)[n+](NC(=O)c2ccccc2)c1C.
What is the InChIKey of N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide?
The InChIKey is HDHWXZDVIZMKFM-UHFFFAOYSA-O. The full InChI is InChI=1S/C17H15ClN4O/c1-12-13(2)21(20-17(23)14-6-4-3-5-7-14)22(19-12)16-10-8-15(18)9-11-16/h3-11H,1-2H3/p+1.
What are the key properties of N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide?
N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide has a molecular weight of 327.80 g/mol, XLogP of 2.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorophenyl)-4,5-dimethyltriazol-1-ium-1-yl]benzamide is sourced from PubChem (CID 11267385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).