C9H13N5O3 — CID 112674235
N-(2-amino-2-oxoethoxy)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide (PubChem CID 112674235) has the molecular formula C9H13N5O3 and a molecular weight of 239.23 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 112674235 |
| Molecular Formula | C9H13N5O3 |
| Molecular Weight | 239.23 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine-6-carboxamide |
| SMILES | NC(=O)CONC(=O)C1Cc2nc[nH]c2CN1 |
| InChI | InChI=1S/C9H13N5O3/c10-8(15)3-17-14-9(16)6-1-5-7(2-11-6)13-4-12-5/h4,6,11H,1-3H2,(H2,10,15)(H,12,13)(H,14,16) |
| InChIKey | YJJDFWHWFOXTIR-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.23 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|