About 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium
3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium (PubChem CID 11267426) has the molecular formula C14H8N4O6
and a molecular weight of 328.24 g/mol. Its IUPAC name is 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium.
Molecular Properties
| Compound Name | 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| PubChem CID | 11267426 |
| Molecular Formula | C14H8N4O6 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.04 |
| IUPAC Name | 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium |
| SMILES | O=[N+]([O-])c1ccc(-c2no[n+]([O-])c2-c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C14H8N4O6/c19-16(20)11-5-1-9(2-6-11)13-14(18(23)24-15-13)10-3-7-12(8-4-10)17(21)22/h1-8H |
| InChIKey | PIIJDKFUMKBHDS-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 139.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The IUPAC name of 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium (CID 11267426) is 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium.
What is the SMILES notation for 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The canonical SMILES for 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium is O=[N+]([O-])c1ccc(-c2no[n+]([O-])c2-c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium?
The InChIKey is PIIJDKFUMKBHDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4O6/c19-16(20)11-5-1-9(2-6-11)13-14(18(23)24-15-13)10-3-7-12(8-4-10)17(21)22/h1-8H.
What are the key properties of 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium?
3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium has a molecular weight of 328.24 g/mol, XLogP of 2.46, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(4-nitrophenyl)-2-oxido-1,2,5-oxadiazol-2-ium is sourced from PubChem (CID 11267426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).