About [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate
[5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate (PubChem CID 11267463) has the molecular formula C15H17ClO6
and a molecular weight of 328.75 g/mol. Its IUPAC name is [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate.
Molecular Properties
| Compound Name | [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate |
| PubChem CID | 11267463 |
| Molecular Formula | C15H17ClO6 |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate |
| SMILES | CC(=O)OCCCC(=O)Cc1c(Cl)c(O)c(C)c(O)c1C=O |
| InChI | InChI=1S/C15H17ClO6/c1-8-14(20)12(7-17)11(13(16)15(8)21)6-10(19)4-3-5-22-9(2)18/h7,20-21H,3-6H2,1-2H3 |
| InChIKey | VRSUMTZVGJUVLC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate?
The IUPAC name of [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate (CID 11267463) is [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate.
What is the SMILES notation for [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate?
The canonical SMILES for [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate is CC(=O)OCCCC(=O)Cc1c(Cl)c(O)c(C)c(O)c1C=O.
What is the InChIKey of [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate?
The InChIKey is VRSUMTZVGJUVLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17ClO6/c1-8-14(20)12(7-17)11(13(16)15(8)21)6-10(19)4-3-5-22-9(2)18/h7,20-21H,3-6H2,1-2H3.
What are the key properties of [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate?
[5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate has a molecular weight of 328.75 g/mol, XLogP of 2.33, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-chloro-6-formyl-3,5-dihydroxy-4-methylphenyl)-4-oxopentyl] acetate is sourced from PubChem (CID 11267463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).