About 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide
2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide (PubChem CID 112675141) has the molecular formula C11H14N4O3S
and a molecular weight of 282.33 g/mol. Its IUPAC name is 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide.
Molecular Properties
| Compound Name | 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide |
| PubChem CID | 112675141 |
| Molecular Formula | C11H14N4O3S |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide |
| SMILES | Cc1cc(Oc2cccc(S(N)(=O)=O)c2N)n(C)n1 |
| InChI | InChI=1S/C11H14N4O3S/c1-7-6-10(15(2)14-7)18-8-4-3-5-9(11(8)12)19(13,16)17/h3-6H,12H2,1-2H3,(H2,13,16,17) |
| InChIKey | XMCXUUIZBFEMRW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 113.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide?
The IUPAC name of 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide (CID 112675141) is 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide.
What is the SMILES notation for 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide?
The canonical SMILES for 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide is Cc1cc(Oc2cccc(S(N)(=O)=O)c2N)n(C)n1.
What is the InChIKey of 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide?
The InChIKey is XMCXUUIZBFEMRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N4O3S/c1-7-6-10(15(2)14-7)18-8-4-3-5-9(11(8)12)19(13,16)17/h3-6H,12H2,1-2H3,(H2,13,16,17).
What are the key properties of 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide?
2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide has a molecular weight of 282.33 g/mol, XLogP of 0.75, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-(2,5-dimethylpyrazol-3-yl)oxybenzenesulfonamide is sourced from PubChem (CID 112675141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).